C12H19ClN2O3 — CID 171206473
3-[(1R)-1-amino-4-methylpentyl]-4-nitrophenol;hydrochloride (PubChem CID 171206473) has the molecular formula C12H19ClN2O3 and a molecular weight of 274.75 g/mol. Its IUPAC name is 3-[(1R)-1-amino-4-methylpentyl]-4-nitrophenol;hydrochloride.
| Compound Name | 3-[(1R)-1-amino-4-methylpentyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171206473 |
| Molecular Formula | C12H19ClN2O3 |
| Molecular Weight | 274.75 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 3-[(1R)-1-amino-4-methylpentyl]-4-nitrophenol;hydrochloride |
| SMILES | CC(C)CC[C@@H](N)c1cc(O)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H18N2O3.ClH/c1-8(2)3-5-11(13)10-7-9(15)4-6-12(10)14(16)17;/h4,6-8,11,15H,3,5,13H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | CITIQLJCXYGDAE-RFVHGSKJSA-N |
| XLogP | 3.16 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.75 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|