C12H19ClN2O4 — CID 171262914
3-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-4-nitrophenol;hydrochloride (PubChem CID 171262914) has the molecular formula C12H19ClN2O4 and a molecular weight of 290.75 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-4-nitrophenol;hydrochloride.
| Compound Name | 3-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171262914 |
| Molecular Formula | C12H19ClN2O4 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-hydroxy-3-methylpentyl]-4-nitrophenol;hydrochloride |
| SMILES | CCC(C)[C@H](O)[C@H](N)c1cc(O)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H18N2O4.ClH/c1-3-7(2)12(16)11(13)9-6-8(15)4-5-10(9)14(17)18;/h4-7,11-12,15-16H,3,13H2,1-2H3;1H/t7?,11-,12+;/m1./s1 |
| InChIKey | WVPZJXRBIIMJDM-QTXTXVRVSA-N |
| XLogP | 2.13 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|