C12H18N2O4 — CID 171268582
3-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-nitrophenol (PubChem CID 171268582) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-nitrophenol.
| Compound Name | 3-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-nitrophenol |
|---|---|
| PubChem CID | 171268582 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 3-[(1S,2R)-1-amino-2-hydroxy-3,3-dimethylbutyl]-4-nitrophenol |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](N)c1cc(O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N2O4/c1-12(2,3)11(16)10(13)8-6-7(15)4-5-9(8)14(17)18/h4-6,10-11,15-16H,13H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | TUTWNNPTOOWKLD-QWRGUYRKSA-N |
| XLogP | 1.71 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|