C14H21ClN2O4 — CID 171262906
3-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-nitrophenol;hydrochloride (PubChem CID 171262906) has the molecular formula C14H21ClN2O4 and a molecular weight of 316.79 g/mol. Its IUPAC name is 3-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-nitrophenol;hydrochloride.
| Compound Name | 3-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171262906 |
| Molecular Formula | C14H21ClN2O4 |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[(1R,2S)-1-amino-2-cyclohexyl-2-hydroxyethyl]-4-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(O)ccc1[N+](=O)[O-])[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C14H20N2O4.ClH/c15-13(14(18)9-4-2-1-3-5-9)11-8-10(17)6-7-12(11)16(19)20;/h6-9,13-14,17-18H,1-5,15H2;1H/t13-,14+;/m1./s1 |
| InChIKey | MVMLOPJHVMJKSB-DFQHDRSWSA-N |
| XLogP | 2.66 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|