C13H20ClNO3 — CID 171261378
2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]benzene-1,4-diol;hydrochloride (PubChem CID 171261378) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]benzene-1,4-diol;hydrochloride.
| Compound Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]benzene-1,4-diol;hydrochloride |
|---|---|
| PubChem CID | 171261378 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-[(1R,2S)-1-amino-2-cyclopentyl-2-hydroxyethyl]benzene-1,4-diol;hydrochloride |
| SMILES | Cl.N[C@H](c1cc(O)ccc1O)[C@@H](O)C1CCCC1 |
| InChI | InChI=1S/C13H19NO3.ClH/c14-12(13(17)8-3-1-2-4-8)10-7-9(15)5-6-11(10)16;/h5-8,12-13,15-17H,1-4,14H2;1H/t12-,13+;/m1./s1 |
| InChIKey | MURRFKVXCOUQEH-KZCZEQIWSA-N |
| XLogP | 2.07 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|