C8H10ClF2NO2 — CID 171246703
2-[(1S)-1-amino-2,2-difluoroethyl]benzene-1,4-diol;hydrochloride (PubChem CID 171246703) has the molecular formula C8H10ClF2NO2 and a molecular weight of 225.62 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2-difluoroethyl]benzene-1,4-diol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-2,2-difluoroethyl]benzene-1,4-diol;hydrochloride |
|---|---|
| PubChem CID | 171246703 |
| Molecular Formula | C8H10ClF2NO2 |
| Molecular Weight | 225.62 g/mol |
| Exact Mass | 225.04 |
| IUPAC Name | 2-[(1S)-1-amino-2,2-difluoroethyl]benzene-1,4-diol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(O)ccc1O)C(F)F |
| InChI | InChI=1S/C8H9F2NO2.ClH/c9-8(10)7(11)5-3-4(12)1-2-6(5)13;/h1-3,7-8,12-13H,11H2;1H/t7-;/m0./s1 |
| InChIKey | BHDKTWYWCKJMCY-FJXQXJEOSA-N |
| XLogP | 1.78 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.62 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|