C9H11F2NOS — CID 130060574
2-(1-amino-2,2-difluoroethyl)-4-methylsulfanylphenol (PubChem CID 130060574) has the molecular formula C9H11F2NOS and a molecular weight of 219.26 g/mol. Its IUPAC name is 2-(1-amino-2,2-difluoroethyl)-4-methylsulfanylphenol.
| Compound Name | 2-(1-amino-2,2-difluoroethyl)-4-methylsulfanylphenol |
|---|---|
| PubChem CID | 130060574 |
| Molecular Formula | C9H11F2NOS |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | 2-(1-amino-2,2-difluoroethyl)-4-methylsulfanylphenol |
| SMILES | CSc1ccc(O)c(C(N)C(F)F)c1 |
| InChI | InChI=1S/C9H11F2NOS/c1-14-5-2-3-7(13)6(4-5)8(12)9(10)11/h2-4,8-9,13H,12H2,1H3 |
| InChIKey | OFZMGIPSCVCJAZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|