C10H15FN2O — CID 130898716
2-(1,2-diaminobutyl)-4-fluorophenol (PubChem CID 130898716) has the molecular formula C10H15FN2O and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-(1,2-diaminobutyl)-4-fluorophenol.
| Compound Name | 2-(1,2-diaminobutyl)-4-fluorophenol |
|---|---|
| PubChem CID | 130898716 |
| Molecular Formula | C10H15FN2O |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-(1,2-diaminobutyl)-4-fluorophenol |
| SMILES | CCC(N)C(N)c1cc(F)ccc1O |
| InChI | InChI=1S/C10H15FN2O/c1-2-8(12)10(13)7-5-6(11)3-4-9(7)14/h3-5,8,10,14H,2,12-13H2,1H3 |
| InChIKey | VCJRBFQXRIEYRP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|