C11H17FN2O — CID 165347841
1-(5-fluoro-2-methoxyphenyl)butane-1,2-diamine (PubChem CID 165347841) has the molecular formula C11H17FN2O and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-(5-fluoro-2-methoxyphenyl)butane-1,2-diamine.
| Compound Name | 1-(5-fluoro-2-methoxyphenyl)butane-1,2-diamine |
|---|---|
| PubChem CID | 165347841 |
| Molecular Formula | C11H17FN2O |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 1-(5-fluoro-2-methoxyphenyl)butane-1,2-diamine |
| SMILES | CCC(N)C(N)c1cc(F)ccc1OC |
| InChI | InChI=1S/C11H17FN2O/c1-3-9(13)11(14)8-6-7(12)4-5-10(8)15-2/h4-6,9,11H,3,13-14H2,1-2H3 |
| InChIKey | KSPCJWHQFPVXMC-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |