C11H17ClFNO2 — CID 171239147
2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-fluorophenol;hydrochloride (PubChem CID 171239147) has the molecular formula C11H17ClFNO2 and a molecular weight of 249.71 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-fluorophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171239147 |
| Molecular Formula | C11H17ClFNO2 |
| Molecular Weight | 249.71 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-fluorophenol;hydrochloride |
| SMILES | CC(C)(CO)[C@H](N)c1cc(F)ccc1O.Cl |
| InChI | InChI=1S/C11H16FNO2.ClH/c1-11(2,6-14)10(13)8-5-7(12)3-4-9(8)15;/h3-5,10,14-15H,6,13H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | VHCORZMQMCKSHR-HNCPQSOCSA-N |
| XLogP | 1.97 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.71 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|