C11H16BrClFNO2 — CID 171253683
2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-bromo-4-fluorophenol;hydrochloride (PubChem CID 171253683) has the molecular formula C11H16BrClFNO2 and a molecular weight of 328.61 g/mol. Its IUPAC name is 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-bromo-4-fluorophenol;hydrochloride.
| Compound Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-bromo-4-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171253683 |
| Molecular Formula | C11H16BrClFNO2 |
| Molecular Weight | 328.61 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | 2-[(1S)-1-amino-3-hydroxy-2,2-dimethylpropyl]-6-bromo-4-fluorophenol;hydrochloride |
| SMILES | CC(C)(CO)[C@H](N)c1cc(F)cc(Br)c1O.Cl |
| InChI | InChI=1S/C11H15BrFNO2.ClH/c1-11(2,5-15)10(14)7-3-6(13)4-8(12)9(7)16;/h3-4,10,15-16H,5,14H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | ILVBFOBLBSGLMT-HNCPQSOCSA-N |
| XLogP | 2.73 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.61 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|