C11H14BrF2NO2 — CID 171257945
6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2,3-difluorophenol (PubChem CID 171257945) has the molecular formula C11H14BrF2NO2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2,3-difluorophenol.
| Compound Name | 6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2,3-difluorophenol |
|---|---|
| PubChem CID | 171257945 |
| Molecular Formula | C11H14BrF2NO2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 6-[(1R)-1-amino-3-hydroxy-2,2-dimethylpropyl]-4-bromo-2,3-difluorophenol |
| SMILES | CC(C)(CO)[C@@H](N)c1cc(Br)c(F)c(F)c1O |
| InChI | InChI=1S/C11H14BrF2NO2/c1-11(2,4-16)10(15)5-3-6(12)7(13)8(14)9(5)17/h3,10,16-17H,4,15H2,1-2H3/t10-/m0/s1 |
| InChIKey | WFELMRANAZKSRD-JTQLQIEISA-N |
| XLogP | 2.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|