C9H10BrF2NO2 — CID 131429576
6-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2,3-difluorophenol (PubChem CID 131429576) has the molecular formula C9H10BrF2NO2 and a molecular weight of 282.08 g/mol. Its IUPAC name is 6-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2,3-difluorophenol.
| Compound Name | 6-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2,3-difluorophenol |
|---|---|
| PubChem CID | 131429576 |
| Molecular Formula | C9H10BrF2NO2 |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 6-[(1R)-1-amino-3-hydroxypropyl]-4-bromo-2,3-difluorophenol |
| SMILES | N[C@H](CCO)c1cc(Br)c(F)c(F)c1O |
| InChI | InChI=1S/C9H10BrF2NO2/c10-5-3-4(6(13)1-2-14)9(15)8(12)7(5)11/h3,6,14-15H,1-2,13H2/t6-/m1/s1 |
| InChIKey | GHZASVMMPDNKFE-ZCFIWIBFSA-N |
| XLogP | 1.82 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|