C9H12BrFN2O — CID 130815027
3-bromo-6-[(1R)-1,3-diaminopropyl]-2-fluorophenol (PubChem CID 130815027) has the molecular formula C9H12BrFN2O and a molecular weight of 263.11 g/mol. Its IUPAC name is 3-bromo-6-[(1R)-1,3-diaminopropyl]-2-fluorophenol.
| Compound Name | 3-bromo-6-[(1R)-1,3-diaminopropyl]-2-fluorophenol |
|---|---|
| PubChem CID | 130815027 |
| Molecular Formula | C9H12BrFN2O |
| Molecular Weight | 263.11 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 3-bromo-6-[(1R)-1,3-diaminopropyl]-2-fluorophenol |
| SMILES | NCC[C@@H](N)c1ccc(Br)c(F)c1O |
| InChI | InChI=1S/C9H12BrFN2O/c10-6-2-1-5(7(13)3-4-12)9(14)8(6)11/h1-2,7,14H,3-4,12-13H2/t7-/m1/s1 |
| InChIKey | KBJCTVDOMDYUMR-SSDOTTSWSA-N |
| XLogP | 1.64 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.11 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|