C9H14ClFN2O — CID 171218427
2-[(1S)-1,3-diaminopropyl]-6-fluorophenol;hydrochloride (PubChem CID 171218427) has the molecular formula C9H14ClFN2O and a molecular weight of 220.67 g/mol. Its IUPAC name is 2-[(1S)-1,3-diaminopropyl]-6-fluorophenol;hydrochloride.
| Compound Name | 2-[(1S)-1,3-diaminopropyl]-6-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171218427 |
| Molecular Formula | C9H14ClFN2O |
| Molecular Weight | 220.67 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[(1S)-1,3-diaminopropyl]-6-fluorophenol;hydrochloride |
| SMILES | Cl.NCC[C@H](N)c1cccc(F)c1O |
| InChI | InChI=1S/C9H13FN2O.ClH/c10-7-3-1-2-6(9(7)13)8(12)4-5-11;/h1-3,8,13H,4-5,11-12H2;1H/t8-;/m0./s1 |
| InChIKey | YGVMXPQVOLKAAL-QRPNPIFTSA-N |
| XLogP | 1.30 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|