C10H13ClFNO — CID 171198918
2-[(1R)-1-aminobut-3-enyl]-6-fluorophenol;hydrochloride (PubChem CID 171198918) has the molecular formula C10H13ClFNO and a molecular weight of 217.67 g/mol. Its IUPAC name is 2-[(1R)-1-aminobut-3-enyl]-6-fluorophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-aminobut-3-enyl]-6-fluorophenol;hydrochloride |
|---|---|
| PubChem CID | 171198918 |
| Molecular Formula | C10H13ClFNO |
| Molecular Weight | 217.67 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-[(1R)-1-aminobut-3-enyl]-6-fluorophenol;hydrochloride |
| SMILES | C=CC[C@@H](N)c1cccc(F)c1O.Cl |
| InChI | InChI=1S/C10H12FNO.ClH/c1-2-4-9(12)7-5-3-6-8(11)10(7)13;/h2-3,5-6,9,13H,1,4,12H2;1H/t9-;/m1./s1 |
| InChIKey | SDDAAMGDIXULRY-SBSPUUFOSA-N |
| XLogP | 2.53 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.67 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|