C11H14FN — CID 131079548
(1S)-1-(3-fluoro-2-methylphenyl)but-3-en-1-amine (PubChem CID 131079548) has the molecular formula C11H14FN and a molecular weight of 179.24 g/mol. Its IUPAC name is (1S)-1-(3-fluoro-2-methylphenyl)but-3-en-1-amine.
| Compound Name | (1S)-1-(3-fluoro-2-methylphenyl)but-3-en-1-amine |
|---|---|
| PubChem CID | 131079548 |
| Molecular Formula | C11H14FN |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | (1S)-1-(3-fluoro-2-methylphenyl)but-3-en-1-amine |
| SMILES | C=CC[C@H](N)c1cccc(F)c1C |
| InChI | InChI=1S/C11H14FN/c1-3-5-11(13)9-6-4-7-10(12)8(9)2/h3-4,6-7,11H,1,5,13H2,2H3/t11-/m0/s1 |
| InChIKey | SQZFYHHTHZVLHE-NSHDSACASA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|