C12H17ClFN — CID 171223401
(1S)-1-(3-fluoro-2-methylphenyl)-3-methylbut-3-en-1-amine;hydrochloride (PubChem CID 171223401) has the molecular formula C12H17ClFN and a molecular weight of 229.73 g/mol. Its IUPAC name is (1S)-1-(3-fluoro-2-methylphenyl)-3-methylbut-3-en-1-amine;hydrochloride.
| Compound Name | (1S)-1-(3-fluoro-2-methylphenyl)-3-methylbut-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171223401 |
| Molecular Formula | C12H17ClFN |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1S)-1-(3-fluoro-2-methylphenyl)-3-methylbut-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)C[C@H](N)c1cccc(F)c1C.Cl |
| InChI | InChI=1S/C12H16FN.ClH/c1-8(2)7-12(14)10-5-4-6-11(13)9(10)3;/h4-6,12H,1,7,14H2,2-3H3;1H/t12-;/m0./s1 |
| InChIKey | BZWZBTVDCGJIGP-YDALLXLXSA-N |
| XLogP | 3.52 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|