C10H12FNO2 — CID 55272321
(3S)-3-amino-3-(3-fluoro-2-methylphenyl)propanoic acid (PubChem CID 55272321) has the molecular formula C10H12FNO2 and a molecular weight of 197.21 g/mol. Its IUPAC name is (3S)-3-amino-3-(3-fluoro-2-methylphenyl)propanoic acid.
| Compound Name | (3S)-3-amino-3-(3-fluoro-2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 55272321 |
| Molecular Formula | C10H12FNO2 |
| Molecular Weight | 197.21 g/mol |
| Exact Mass | 197.09 |
| IUPAC Name | (3S)-3-amino-3-(3-fluoro-2-methylphenyl)propanoic acid |
| SMILES | Cc1c(F)cccc1[C@@H](N)CC(=O)O |
| InChI | InChI=1S/C10H12FNO2/c1-6-7(3-2-4-8(6)11)9(12)5-10(13)14/h2-4,9H,5,12H2,1H3,(H,13,14)/t9-/m0/s1 |
| InChIKey | NWJCIWQNZQSADS-VIFPVBQESA-N |
| XLogP | 1.61 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |