C9H13N3O2 — CID 55268840
(3S)-3-amino-3-(2,3-diaminophenyl)propanoic acid (PubChem CID 55268840) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is (3S)-3-amino-3-(2,3-diaminophenyl)propanoic acid.
| Compound Name | (3S)-3-amino-3-(2,3-diaminophenyl)propanoic acid |
|---|---|
| PubChem CID | 55268840 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | (3S)-3-amino-3-(2,3-diaminophenyl)propanoic acid |
| SMILES | Nc1cccc([C@@H](N)CC(=O)O)c1N |
| InChI | InChI=1S/C9H13N3O2/c10-6-3-1-2-5(9(6)12)7(11)4-8(13)14/h1-3,7H,4,10-12H2,(H,13,14)/t7-/m0/s1 |
| InChIKey | JQMVVCKXRPKMQD-ZETCQYMHSA-N |
| XLogP | 0.33 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|