C11H15ClFNO2 — CID 171247663
methyl (3R)-3-amino-3-(3-fluoro-2-methylphenyl)propanoate;hydrochloride (PubChem CID 171247663) has the molecular formula C11H15ClFNO2 and a molecular weight of 247.70 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-fluoro-2-methylphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(3-fluoro-2-methylphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171247663 |
| Molecular Formula | C11H15ClFNO2 |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-fluoro-2-methylphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1cccc(F)c1C.Cl |
| InChI | InChI=1S/C11H14FNO2.ClH/c1-7-8(4-3-5-9(7)12)10(13)6-11(14)15-2;/h3-5,10H,6,13H2,1-2H3;1H/t10-;/m1./s1 |
| InChIKey | UJHXXJWMEQFMOR-HNCPQSOCSA-N |
| XLogP | 2.12 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |