C10H13ClINO2 — CID 171243191
methyl (3S)-3-amino-3-(2-iodophenyl)propanoate;hydrochloride (PubChem CID 171243191) has the molecular formula C10H13ClINO2 and a molecular weight of 341.58 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(2-iodophenyl)propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(2-iodophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171243191 |
| Molecular Formula | C10H13ClINO2 |
| Molecular Weight | 341.58 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | methyl (3S)-3-amino-3-(2-iodophenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1ccccc1I.Cl |
| InChI | InChI=1S/C10H12INO2.ClH/c1-14-10(13)6-9(12)7-4-2-3-5-8(7)11;/h2-5,9H,6,12H2,1H3;1H/t9-;/m0./s1 |
| InChIKey | SBGYDKLJJAOFGW-FVGYRXGTSA-N |
| XLogP | 2.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.58 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|