C11H16ClNO4 — CID 171243705
methyl (3S)-3-amino-3-(2-hydroxy-3-methoxyphenyl)propanoate;hydrochloride (PubChem CID 171243705) has the molecular formula C11H16ClNO4 and a molecular weight of 261.71 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(2-hydroxy-3-methoxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(2-hydroxy-3-methoxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171243705 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | methyl (3S)-3-amino-3-(2-hydroxy-3-methoxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1cccc(OC)c1O.Cl |
| InChI | InChI=1S/C11H15NO4.ClH/c1-15-9-5-3-4-7(11(9)14)8(12)6-10(13)16-2;/h3-5,8,14H,6,12H2,1-2H3;1H/t8-;/m0./s1 |
| InChIKey | XJNDWEDYYJAQQR-QRPNPIFTSA-N |
| XLogP | 1.39 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|