C11H13ClN2O3 — CID 171259234
methyl (3R)-3-amino-3-(3-cyano-2-hydroxyphenyl)propanoate;hydrochloride (PubChem CID 171259234) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3-cyano-2-hydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(3-cyano-2-hydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171259234 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl (3R)-3-amino-3-(3-cyano-2-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1cccc(C#N)c1O.Cl |
| InChI | InChI=1S/C11H12N2O3.ClH/c1-16-10(14)5-9(13)8-4-2-3-7(6-12)11(8)15;/h2-4,9,15H,5,13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | VLWKUUNZWBCRQX-SBSPUUFOSA-N |
| XLogP | 1.25 |
| TPSA | 96.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|