C10H12Cl3NO3 — CID 171253992
methyl (3S)-3-amino-3-(3,4-dichloro-2-hydroxyphenyl)propanoate;hydrochloride (PubChem CID 171253992) has the molecular formula C10H12Cl3NO3 and a molecular weight of 300.57 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(3,4-dichloro-2-hydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3S)-3-amino-3-(3,4-dichloro-2-hydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171253992 |
| Molecular Formula | C10H12Cl3NO3 |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 298.99 |
| IUPAC Name | methyl (3S)-3-amino-3-(3,4-dichloro-2-hydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@H](N)c1ccc(Cl)c(Cl)c1O.Cl |
| InChI | InChI=1S/C10H11Cl2NO3.ClH/c1-16-8(14)4-7(13)5-2-3-6(11)9(12)10(5)15;/h2-3,7,15H,4,13H2,1H3;1H/t7-;/m0./s1 |
| InChIKey | XWPDREAXBHXXAR-FJXQXJEOSA-N |
| XLogP | 2.68 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|