C10H14ClNO4 — CID 171246307
methyl (3R)-3-amino-3-(2,4-dihydroxyphenyl)propanoate;hydrochloride (PubChem CID 171246307) has the molecular formula C10H14ClNO4 and a molecular weight of 247.68 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(2,4-dihydroxyphenyl)propanoate;hydrochloride.
| Compound Name | methyl (3R)-3-amino-3-(2,4-dihydroxyphenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 171246307 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | methyl (3R)-3-amino-3-(2,4-dihydroxyphenyl)propanoate;hydrochloride |
| SMILES | COC(=O)C[C@@H](N)c1ccc(O)cc1O.Cl |
| InChI | InChI=1S/C10H13NO4.ClH/c1-15-10(14)5-8(11)7-3-2-6(12)4-9(7)13;/h2-4,8,12-13H,5,11H2,1H3;1H/t8-;/m1./s1 |
| InChIKey | WFMRCSZOTFWQCT-DDWIOCJRSA-N |
| XLogP | 1.08 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|