C10H13NO4 — CID 171239593
methyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)propanoate (PubChem CID 171239593) has the molecular formula C10H13NO4 and a molecular weight of 211.22 g/mol. Its IUPAC name is methyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)propanoate.
| Compound Name | methyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171239593 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | methyl (3S)-3-amino-3-(2,4-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)C[C@H](N)c1ccc(O)cc1O |
| InChI | InChI=1S/C10H13NO4/c1-15-10(14)5-8(11)7-3-2-6(12)4-9(7)13/h2-4,8,12-13H,5,11H2,1H3/t8-/m0/s1 |
| InChIKey | BIMOXRPGLIESFV-QMMMGPOBSA-N |
| XLogP | 0.66 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|