C10H11Cl2NO3 — CID 171245408
methyl (3R)-3-amino-3-(3,5-dichloro-2-hydroxyphenyl)propanoate (PubChem CID 171245408) has the molecular formula C10H11Cl2NO3 and a molecular weight of 264.11 g/mol. Its IUPAC name is methyl (3R)-3-amino-3-(3,5-dichloro-2-hydroxyphenyl)propanoate.
| Compound Name | methyl (3R)-3-amino-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 171245408 |
| Molecular Formula | C10H11Cl2NO3 |
| Molecular Weight | 264.11 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | methyl (3R)-3-amino-3-(3,5-dichloro-2-hydroxyphenyl)propanoate |
| SMILES | COC(=O)C[C@@H](N)c1cc(Cl)cc(Cl)c1O |
| InChI | InChI=1S/C10H11Cl2NO3/c1-16-9(14)4-8(13)6-2-5(11)3-7(12)10(6)15/h2-3,8,15H,4,13H2,1H3/t8-/m1/s1 |
| InChIKey | DISNNIALWLPDEH-MRVPVSSYSA-N |
| XLogP | 2.26 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.11 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|