C10H12ClNO4 — CID 117366506
3-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoic acid (PubChem CID 117366506) has the molecular formula C10H12ClNO4 and a molecular weight of 245.66 g/mol. Its IUPAC name is 3-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117366506 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.66 g/mol |
| Exact Mass | 245.05 |
| IUPAC Name | 3-amino-3-(5-chloro-2-hydroxy-3-methoxyphenyl)propanoic acid |
| SMILES | COc1cc(Cl)cc(C(N)CC(=O)O)c1O |
| InChI | InChI=1S/C10H12ClNO4/c1-16-8-3-5(11)2-6(10(8)15)7(12)4-9(13)14/h2-3,7,15H,4,12H2,1H3,(H,13,14) |
| InChIKey | NDOXBSYJHTXXNT-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.66 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|