C13H18ClNO4 — CID 117464423
3-amino-3-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)propanoic acid (PubChem CID 117464423) has the molecular formula C13H18ClNO4 and a molecular weight of 287.74 g/mol. Its IUPAC name is 3-amino-3-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)propanoic acid.
| Compound Name | 3-amino-3-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 117464423 |
| Molecular Formula | C13H18ClNO4 |
| Molecular Weight | 287.74 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 3-amino-3-(5-chloro-3-methoxy-2-propan-2-yloxyphenyl)propanoic acid |
| SMILES | COc1cc(Cl)cc(C(N)CC(=O)O)c1OC(C)C |
| InChI | InChI=1S/C13H18ClNO4/c1-7(2)19-13-9(10(15)6-12(16)17)4-8(14)5-11(13)18-3/h4-5,7,10H,6,15H2,1-3H3,(H,16,17) |
| InChIKey | BBDWHZCWZWUQOI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.74 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |