C10H15ClN2O2 — CID 66518018
(1R)-1-(5-chloro-2,3-dimethoxyphenyl)ethane-1,2-diamine (PubChem CID 66518018) has the molecular formula C10H15ClN2O2 and a molecular weight of 230.69 g/mol. Its IUPAC name is (1R)-1-(5-chloro-2,3-dimethoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(5-chloro-2,3-dimethoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66518018 |
| Molecular Formula | C10H15ClN2O2 |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1R)-1-(5-chloro-2,3-dimethoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1cc(Cl)cc([C@@H](N)CN)c1OC |
| InChI | InChI=1S/C10H15ClN2O2/c1-14-9-4-6(11)3-7(8(13)5-12)10(9)15-2/h3-4,8H,5,12-13H2,1-2H3/t8-/m0/s1 |
| InChIKey | LUDDMLSBUJFSHF-QMMMGPOBSA-N |
| XLogP | 1.32 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |