C9H12Cl2N2O — CID 66517963
(1R)-1-(3,5-dichloro-2-methoxyphenyl)ethane-1,2-diamine (PubChem CID 66517963) has the molecular formula C9H12Cl2N2O and a molecular weight of 235.11 g/mol. Its IUPAC name is (1R)-1-(3,5-dichloro-2-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | (1R)-1-(3,5-dichloro-2-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66517963 |
| Molecular Formula | C9H12Cl2N2O |
| Molecular Weight | 235.11 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | (1R)-1-(3,5-dichloro-2-methoxyphenyl)ethane-1,2-diamine |
| SMILES | COc1c(Cl)cc(Cl)cc1[C@@H](N)CN |
| InChI | InChI=1S/C9H12Cl2N2O/c1-14-9-6(8(13)4-12)2-5(10)3-7(9)11/h2-3,8H,4,12-13H2,1H3/t8-/m0/s1 |
| InChIKey | RFEJSTLCYFFGHF-QMMMGPOBSA-N |
| XLogP | 1.96 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.11 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |