C11H15Cl2NO3 — CID 83941077
2-amino-1-(3,5-dichloro-2-methoxyphenyl)butane-1,4-diol (PubChem CID 83941077) has the molecular formula C11H15Cl2NO3 and a molecular weight of 280.15 g/mol. Its IUPAC name is 2-amino-1-(3,5-dichloro-2-methoxyphenyl)butane-1,4-diol.
| Compound Name | 2-amino-1-(3,5-dichloro-2-methoxyphenyl)butane-1,4-diol |
|---|---|
| PubChem CID | 83941077 |
| Molecular Formula | C11H15Cl2NO3 |
| Molecular Weight | 280.15 g/mol |
| Exact Mass | 279.04 |
| IUPAC Name | 2-amino-1-(3,5-dichloro-2-methoxyphenyl)butane-1,4-diol |
| SMILES | COc1c(Cl)cc(Cl)cc1C(O)C(N)CCO |
| InChI | InChI=1S/C11H15Cl2NO3/c1-17-11-7(4-6(12)5-8(11)13)10(16)9(14)2-3-15/h4-5,9-10,15-16H,2-3,14H2,1H3 |
| InChIKey | KUGDPNWHQFZICO-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |