C16H27ClN2O2 — CID 83938839
2-amino-1-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)-4-(methylamino)butan-1-ol (PubChem CID 83938839) has the molecular formula C16H27ClN2O2 and a molecular weight of 314.86 g/mol. Its IUPAC name is 2-amino-1-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)-4-(methylamino)butan-1-ol.
| Compound Name | 2-amino-1-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)-4-(methylamino)butan-1-ol |
|---|---|
| PubChem CID | 83938839 |
| Molecular Formula | C16H27ClN2O2 |
| Molecular Weight | 314.86 g/mol |
| Exact Mass | 314.18 |
| IUPAC Name | 2-amino-1-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)-4-(methylamino)butan-1-ol |
| SMILES | CCOc1c(C(C)C)cc(Cl)cc1C(O)C(N)CCNC |
| InChI | InChI=1S/C16H27ClN2O2/c1-5-21-16-12(10(2)3)8-11(17)9-13(16)15(20)14(18)6-7-19-4/h8-10,14-15,19-20H,5-7,18H2,1-4H3 |
| InChIKey | APSJIEQWZHOXFZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.86 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |