C17H27ClO3 — CID 83938916
4-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)hexane-1,2-diol (PubChem CID 83938916) has the molecular formula C17H27ClO3 and a molecular weight of 314.85 g/mol. Its IUPAC name is 4-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)hexane-1,2-diol.
| Compound Name | 4-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83938916 |
| Molecular Formula | C17H27ClO3 |
| Molecular Weight | 314.85 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 4-(5-chloro-2-ethoxy-3-propan-2-ylphenyl)hexane-1,2-diol |
| SMILES | CCOc1c(C(C)C)cc(Cl)cc1C(CC)CC(O)CO |
| InChI | InChI=1S/C17H27ClO3/c1-5-12(7-14(20)10-19)16-9-13(18)8-15(11(3)4)17(16)21-6-2/h8-9,11-12,14,19-20H,5-7,10H2,1-4H3 |
| InChIKey | UXJWIYRJSXJOTJ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.85 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |