C16H26O4 — CID 83923632
4-(3,4-diethoxyphenyl)hexane-1,2-diol (PubChem CID 83923632) has the molecular formula C16H26O4 and a molecular weight of 282.38 g/mol. Its IUPAC name is 4-(3,4-diethoxyphenyl)hexane-1,2-diol.
| Compound Name | 4-(3,4-diethoxyphenyl)hexane-1,2-diol |
|---|---|
| PubChem CID | 83923632 |
| Molecular Formula | C16H26O4 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-(3,4-diethoxyphenyl)hexane-1,2-diol |
| SMILES | CCOc1ccc(C(CC)CC(O)CO)cc1OCC |
| InChI | InChI=1S/C16H26O4/c1-4-12(9-14(18)11-17)13-7-8-15(19-5-2)16(10-13)20-6-3/h7-8,10,12,14,17-18H,4-6,9,11H2,1-3H3 |
| InChIKey | LZRDSFLCWQLYDW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |