C15H25NO3 — CID 83923626
1-amino-4-(3,4-diethoxyphenyl)pentan-2-ol (PubChem CID 83923626) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 1-amino-4-(3,4-diethoxyphenyl)pentan-2-ol.
| Compound Name | 1-amino-4-(3,4-diethoxyphenyl)pentan-2-ol |
|---|---|
| PubChem CID | 83923626 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 1-amino-4-(3,4-diethoxyphenyl)pentan-2-ol |
| SMILES | CCOc1ccc(C(C)CC(O)CN)cc1OCC |
| InChI | InChI=1S/C15H25NO3/c1-4-18-14-7-6-12(9-15(14)19-5-2)11(3)8-13(17)10-16/h6-7,9,11,13,17H,4-5,8,10,16H2,1-3H3 |
| InChIKey | CFWWOZUKGWVQFY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |