C18H30O3 — CID 83935306
6-(4-ethoxy-3-propan-2-ylphenyl)heptane-3,4-diol (PubChem CID 83935306) has the molecular formula C18H30O3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-(4-ethoxy-3-propan-2-ylphenyl)heptane-3,4-diol.
| Compound Name | 6-(4-ethoxy-3-propan-2-ylphenyl)heptane-3,4-diol |
|---|---|
| PubChem CID | 83935306 |
| Molecular Formula | C18H30O3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | 6-(4-ethoxy-3-propan-2-ylphenyl)heptane-3,4-diol |
| SMILES | CCOc1ccc(C(C)CC(O)C(O)CC)cc1C(C)C |
| InChI | InChI=1S/C18H30O3/c1-6-16(19)17(20)10-13(5)14-8-9-18(21-7-2)15(11-14)12(3)4/h8-9,11-13,16-17,19-20H,6-7,10H2,1-5H3 |
| InChIKey | BAIVHSNVDYCDRC-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |