C16H27NO3 — CID 83928886
5-amino-2-(3,4-dimethoxyphenyl)octan-4-ol (PubChem CID 83928886) has the molecular formula C16H27NO3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 5-amino-2-(3,4-dimethoxyphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(3,4-dimethoxyphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83928886 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 5-amino-2-(3,4-dimethoxyphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C16H27NO3/c1-5-6-13(17)14(18)9-11(2)12-7-8-15(19-3)16(10-12)20-4/h7-8,10-11,13-14,18H,5-6,9,17H2,1-4H3 |
| InChIKey | UGTBJJMVXYGRJB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |