C16H26ClNO3 — CID 83943374
5-amino-2-(5-chloro-2,4-dimethoxyphenyl)octan-4-ol (PubChem CID 83943374) has the molecular formula C16H26ClNO3 and a molecular weight of 315.84 g/mol. Its IUPAC name is 5-amino-2-(5-chloro-2,4-dimethoxyphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(5-chloro-2,4-dimethoxyphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83943374 |
| Molecular Formula | C16H26ClNO3 |
| Molecular Weight | 315.84 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 5-amino-2-(5-chloro-2,4-dimethoxyphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1cc(Cl)c(OC)cc1OC |
| InChI | InChI=1S/C16H26ClNO3/c1-5-6-13(18)14(19)7-10(2)11-8-12(17)16(21-4)9-15(11)20-3/h8-10,13-14,19H,5-7,18H2,1-4H3 |
| InChIKey | RMNPDRHMDOYZIA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.84 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |