C18H30FNO3 — CID 83923165
5-amino-2-(4,5-diethoxy-2-fluorophenyl)octan-4-ol (PubChem CID 83923165) has the molecular formula C18H30FNO3 and a molecular weight of 327.44 g/mol. Its IUPAC name is 5-amino-2-(4,5-diethoxy-2-fluorophenyl)octan-4-ol.
| Compound Name | 5-amino-2-(4,5-diethoxy-2-fluorophenyl)octan-4-ol |
|---|---|
| PubChem CID | 83923165 |
| Molecular Formula | C18H30FNO3 |
| Molecular Weight | 327.44 g/mol |
| Exact Mass | 327.22 |
| IUPAC Name | 5-amino-2-(4,5-diethoxy-2-fluorophenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1cc(OCC)c(OCC)cc1F |
| InChI | InChI=1S/C18H30FNO3/c1-5-8-15(20)16(21)9-12(4)13-10-17(22-6-2)18(23-7-3)11-14(13)19/h10-12,15-16,21H,5-9,20H2,1-4H3 |
| InChIKey | NJKKJBOXYQCAMK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.44 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |