C18H31NO — CID 83921005
5-amino-2-(2,5-diethylphenyl)octan-4-ol (PubChem CID 83921005) has the molecular formula C18H31NO and a molecular weight of 277.45 g/mol. Its IUPAC name is 5-amino-2-(2,5-diethylphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(2,5-diethylphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83921005 |
| Molecular Formula | C18H31NO |
| Molecular Weight | 277.45 g/mol |
| Exact Mass | 277.24 |
| IUPAC Name | 5-amino-2-(2,5-diethylphenyl)octan-4-ol |
| SMILES | CCCC(N)C(O)CC(C)c1cc(CC)ccc1CC |
| InChI | InChI=1S/C18H31NO/c1-5-8-17(19)18(20)11-13(4)16-12-14(6-2)9-10-15(16)7-3/h9-10,12-13,17-18,20H,5-8,11,19H2,1-4H3 |
| InChIKey | PFHIPYMMIDXJKD-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |