C19H33NO2 — CID 83941032
5-amino-2-(2,5-dimethyl-4-propoxyphenyl)octan-4-ol (PubChem CID 83941032) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 5-amino-2-(2,5-dimethyl-4-propoxyphenyl)octan-4-ol.
| Compound Name | 5-amino-2-(2,5-dimethyl-4-propoxyphenyl)octan-4-ol |
|---|---|
| PubChem CID | 83941032 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 5-amino-2-(2,5-dimethyl-4-propoxyphenyl)octan-4-ol |
| SMILES | CCCOc1cc(C)c(C(C)CC(O)C(N)CCC)cc1C |
| InChI | InChI=1S/C19H33NO2/c1-6-8-17(20)18(21)11-13(3)16-10-15(5)19(12-14(16)4)22-9-7-2/h10,12-13,17-18,21H,6-9,11,20H2,1-5H3 |
| InChIKey | CBPGHGYDJQGFJO-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |