C16H25ClO3 — CID 83937822
5-(5-chloro-4-methyl-2-propoxyphenyl)hexane-2,3-diol (PubChem CID 83937822) has the molecular formula C16H25ClO3 and a molecular weight of 300.83 g/mol. Its IUPAC name is 5-(5-chloro-4-methyl-2-propoxyphenyl)hexane-2,3-diol.
| Compound Name | 5-(5-chloro-4-methyl-2-propoxyphenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83937822 |
| Molecular Formula | C16H25ClO3 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | 5-(5-chloro-4-methyl-2-propoxyphenyl)hexane-2,3-diol |
| SMILES | CCCOc1cc(C)c(Cl)cc1C(C)CC(O)C(C)O |
| InChI | InChI=1S/C16H25ClO3/c1-5-6-20-16-8-11(3)14(17)9-13(16)10(2)7-15(19)12(4)18/h8-10,12,15,18-19H,5-7H2,1-4H3 |
| InChIKey | KASWKWIQKLKAHP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |