C14H21ClO2 — CID 83931560
5-(2-chloro-4,5-dimethylphenyl)hexane-2,3-diol (PubChem CID 83931560) has the molecular formula C14H21ClO2 and a molecular weight of 256.77 g/mol. Its IUPAC name is 5-(2-chloro-4,5-dimethylphenyl)hexane-2,3-diol.
| Compound Name | 5-(2-chloro-4,5-dimethylphenyl)hexane-2,3-diol |
|---|---|
| PubChem CID | 83931560 |
| Molecular Formula | C14H21ClO2 |
| Molecular Weight | 256.77 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 5-(2-chloro-4,5-dimethylphenyl)hexane-2,3-diol |
| SMILES | Cc1cc(Cl)c(C(C)CC(O)C(C)O)cc1C |
| InChI | InChI=1S/C14H21ClO2/c1-8-5-12(13(15)6-9(8)2)10(3)7-14(17)11(4)16/h5-6,10-11,14,16-17H,7H2,1-4H3 |
| InChIKey | IWVXUWWYGDVZLH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |