C13H19ClO — CID 115484513
1-(2-chloro-4,5-dimethylphenyl)pentan-1-ol (PubChem CID 115484513) has the molecular formula C13H19ClO and a molecular weight of 226.75 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)pentan-1-ol.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)pentan-1-ol |
|---|---|
| PubChem CID | 115484513 |
| Molecular Formula | C13H19ClO |
| Molecular Weight | 226.75 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)pentan-1-ol |
| SMILES | CCCCC(O)c1cc(C)c(C)cc1Cl |
| InChI | InChI=1S/C13H19ClO/c1-4-5-6-13(15)11-7-9(2)10(3)8-12(11)14/h7-8,13,15H,4-6H2,1-3H3 |
| InChIKey | XXHNQINIICEYMV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.75 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |