C16H15ClF2O — CID 115484531
1-(2-chloro-4,5-dimethylphenyl)-2-(3,4-difluorophenyl)ethanol (PubChem CID 115484531) has the molecular formula C16H15ClF2O and a molecular weight of 296.74 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)-2-(3,4-difluorophenyl)ethanol.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)-2-(3,4-difluorophenyl)ethanol |
|---|---|
| PubChem CID | 115484531 |
| Molecular Formula | C16H15ClF2O |
| Molecular Weight | 296.74 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)-2-(3,4-difluorophenyl)ethanol |
| SMILES | Cc1cc(Cl)c(C(O)Cc2ccc(F)c(F)c2)cc1C |
| InChI | InChI=1S/C16H15ClF2O/c1-9-5-12(13(17)6-10(9)2)16(20)8-11-3-4-14(18)15(19)7-11/h3-7,16,20H,8H2,1-2H3 |
| InChIKey | CUPNHVIFQAAJGT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |