C16H16ClFO — CID 115484522
1-(2-chloro-4,5-dimethylphenyl)-2-(3-fluorophenyl)ethanol (PubChem CID 115484522) has the molecular formula C16H16ClFO and a molecular weight of 278.75 g/mol. Its IUPAC name is 1-(2-chloro-4,5-dimethylphenyl)-2-(3-fluorophenyl)ethanol.
| Compound Name | 1-(2-chloro-4,5-dimethylphenyl)-2-(3-fluorophenyl)ethanol |
|---|---|
| PubChem CID | 115484522 |
| Molecular Formula | C16H16ClFO |
| Molecular Weight | 278.75 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(2-chloro-4,5-dimethylphenyl)-2-(3-fluorophenyl)ethanol |
| SMILES | Cc1cc(Cl)c(C(O)Cc2cccc(F)c2)cc1C |
| InChI | InChI=1S/C16H16ClFO/c1-10-6-14(15(17)7-11(10)2)16(19)9-12-4-3-5-13(18)8-12/h3-8,16,19H,9H2,1-2H3 |
| InChIKey | DEHCPYREYZPGIC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.75 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |