C14H10F4O — CID 103303315
2-(3-fluorophenyl)-1-(2,4,5-trifluorophenyl)ethanol (PubChem CID 103303315) has the molecular formula C14H10F4O and a molecular weight of 270.22 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-1-(2,4,5-trifluorophenyl)ethanol.
| Compound Name | 2-(3-fluorophenyl)-1-(2,4,5-trifluorophenyl)ethanol |
|---|---|
| PubChem CID | 103303315 |
| Molecular Formula | C14H10F4O |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-(3-fluorophenyl)-1-(2,4,5-trifluorophenyl)ethanol |
| SMILES | OC(Cc1cccc(F)c1)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H10F4O/c15-9-3-1-2-8(4-9)5-14(19)10-6-12(17)13(18)7-11(10)16/h1-4,6-7,14,19H,5H2 |
| InChIKey | RNLOAZRZSQYFDD-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|