C17H19ClO — CID 64989886
2-(4-chlorophenyl)-1-(2,4,5-trimethylphenyl)ethanol (PubChem CID 64989886) has the molecular formula C17H19ClO and a molecular weight of 274.79 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(2,4,5-trimethylphenyl)ethanol.
| Compound Name | 2-(4-chlorophenyl)-1-(2,4,5-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 64989886 |
| Molecular Formula | C17H19ClO |
| Molecular Weight | 274.79 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(2,4,5-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(O)Cc2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C17H19ClO/c1-11-8-13(3)16(9-12(11)2)17(19)10-14-4-6-15(18)7-5-14/h4-9,17,19H,10H2,1-3H3 |
| InChIKey | ISGHZOICTFQISQ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.79 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |